| Approval: | ISO |
|---|---|
| IUPAC PIN: | S-[(4-methoxyphenyl)methyl] diethylcarbamothioate |
| IUPAC name: | S-(4-methoxybenzyl) diethylcarbamothioate 1979 Rules: S-(4-methoxybenzyl) diethyl(thiocarbamate) |
| CAS name: | S-[(4-methoxyphenyl)methyl] N,N-diethylcarbamothioate |
| CAS Reg. No.: | 18357-78-3 |
| Formula: | C13H19NO2S |
| Activity: | herbicides (thiocarbamate) |
| Notes: | |
| Structure: | |
| Pronunciation: | mě-thī-ō-běn-karb Guide to British pronunciation |
| InChIKey: | BUHNESFUCHPWED-UHFFFAOYSA-N |
| InChI: | InChI=1S/C13H19NO2S/c1-4-14(5-2)13(15)17-10-11-6-8-12(16-3)9-7-11/h6-9H,4-5,10H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names