| Approval: | ISO |
|---|---|
| IUPAC PIN: | methyl (1Ξ)-N-[(methylcarbamoyl)oxy]ethanimidothioate |
| IUPAC name: | methyl (EZ)-N-[(methylcarbamoyl)oxy]thioacetimidate |
| CAS name: | methyl N-[[(methylamino)carbonyl]oxy]ethanimidothioate |
| CAS Reg. No.: | 16752-77-5 |
| Formula: | C5H10N2O2S |
| Activity: | insecticides (oxime carbamate) |
| Notes: | |
| Structure: | |
| Pronunciation: | měth-ō-mīl Guide to British pronunciation |
| InChIKey: | UHXUZOCRWCRNSJ-UHFFFAOYSA-N |
| InChI: | InChI=1S/C5H10N2O2S/c1-4(10-3)7-9-5(8)6-2/h1-3H3,(H,6,8) |
A data sheet from the Compendium of Pesticide Common Names