| Approval: | ISO common name not required |
|---|---|
| IUPAC PIN: | naphthalene |
| IUPAC name: | naphthalene |
| CAS name: | naphthalene |
| CAS Reg. No.: | 91-20-3 |
| Formula: | C10H8 |
| Activity: | insecticides (aromatic hydrocarbon) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: |  |
| Pronunciation: | nǎf-tha-lēn Guide to British pronunciation |
| InChIKey: | UFWIBTONFRDIAS-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H8/c1-2-6-10-8-4-3-7-9(10)5-1/h1-8H |