| Approval: | JMAFF |
|---|---|
| IUPAC PIN: | rac-(2R)-2-(naphthalen-2-yloxy)-N-phenylpropanamide |
| IUPAC name: | (2RS)-2-(2-naphthyloxy)propananilide 1979 Rules: (RS)-2-(2-naphthyloxy)propionanilide |
| CAS name: | 2-(2-naphthalenyloxy)-N-phenylpropanamide |
| CAS Reg. No.: | 52570-16-8 |
| Formula: | C19H17NO2 |
| Activity: | herbicides (acetamide) |
| Notes: | There is no ISO common name for this substance; the name “naproanilide” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries, and is also approved in China (萘丙胺). |
| Structure: |  |
| Pronunciation: | nǎ-prō-ǎn-ǐ-līd Guide to British pronunciation |
| InChIKey: | LVKTWOXHRYGDMM-UHFFFAOYSA-N |
| InChI: | InChI=1S/C19H17NO2/c1-14(19(21)20-17-9-3-2-4-10-17)22-18-12-11-15-7-5-6-8-16(15)13-18/h2-14H,1H3,(H,20,21) |