| Approval: | ISO common name not required |
|---|---|
| IUPAC PIN: | 3-[(2S)-1-methylpyrrolidin-2-yl]pyridine |
| IUPAC name: | 3-[(2S)-1-methylpyrrolidin-2-yl]pyridine |
| CAS name: | 3-[(2S)-1-methyl-2-pyrrolidinyl]pyridine |
| CAS Reg. No.: | 54-11-5 |
| Formula: | C10H14N2 |
| Activity: | insecticides (alkaloid) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. Derivatives include nicotine sulfate [65-30-5]. |
| Structure: |  |
| Pronunciation: | nǐk-ō-tēn Guide to British pronunciation |
| InChIKey: | SNICXCGAKADSCV-JTQLQIEISA-N |
| InChI: | InChI=1S/C10H14N2/c1-12-7-3-5-10(12)9-4-2-6-11-8-9/h2,4,6,8,10H,3,5,7H2,1H3/t10-/m0/s1 |