| Approval: | ISO |
|---|---|
| IUPAC PIN: | methyl (1Ξ)-2-(dimethylamino)-N-[(methylcarbamoyl)oxy]-2-oxoethanimidothioate |
| IUPAC name: | methyl (EZ)-2-(dimethylamino)-N-[(methylcarbamoyl)oxy]-2-oxothioacetimidate 1979 Rules: S-methyl N′,N′-dimethyl-N-[(methylcarbamoyl)oxy]thiooxamimidate |
| CAS name: | methyl 2-(dimethylamino)-N-[[(methylamino)carbonyl]oxy]-2-oxoethanimidothioate |
| CAS Reg. No.: | 23135-22-0 |
| Formula: | C7H13N3O3S |
| Activity: | acaricides (oxime carbamate) insecticides (oxime carbamate) nematicides (oxime carbamate) |
| Notes: | The name “thioxamyl” has been used in the literature, but it has no official approval. |
| Structure: |  |
| Pronunciation: | ǒks-a-mīl Guide to British pronunciation |
| InChIKey: | KZAUOCCYDRDERY-UHFFFAOYSA-N |
| InChI: | InChI=1S/C7H13N3O3S/c1-8-7(12)13-9-5(14-4)6(11)10(2)3/h1-4H3,(H,8,12) |