| Approval: | ISO |
|---|---|
| IUPAC PIN: | 5-ethyl-8-oxo-5,8-dihydro-2H-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid |
| IUPAC name: | 5-ethyl-5,8-dihydro-8-oxo[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid |
| CAS name: | 5-ethyl-5,8-dihydro-8-oxo-1,3-dioxolo[4,5-g]quinoline-7-carboxylic acid |
| CAS Reg. No.: | 14698-29-4 |
| Formula: | C13H11NO5 |
| Activity: | bactericides |
| Notes: | The name “oxolinic acid” is also approved by by the World Health Organization; the Chinese version is “奥索利酸” and the Russian version is “оксолиновая кислота”. |
| Structure: | |
| Pronunciation: | ǒks-ō-lǐn-ǐk ǎs-ǐd Guide to British pronunciation |
| InChIKey: | KYGZCKSPAKDVKC-UHFFFAOYSA-N |
| InChI: | InChI=1S/C13H11NO5/c1-2-14-5-8(13(16)17)12(15)7-3-10-11(4-9(7)14)19-6-18-10/h3-5H,2,6H2,1H3,(H,16,17) |
A data sheet from the Compendium of Pesticide Common Names