| Approval: | ISO common name not required |
|---|---|
| IUPAC PIN: | |
| IUPAC name: | (4R,7aS,13aR,13bR,13cS)-dodecahydro-10-oxo-1H,5H,10H-dipyrido[2,1-f:3′,2′,1′-ij][1,6]naphthyridin-4-ium-4-olate |
| CAS name: | (4R,7aS,13aR,13bR,13cS)-dodecahydro-1H,5H,10H-dipyrido[2,1-f:3′,2′,1′-ij][1,6]naphthyridin-10-one 4-oxide |
| CAS Reg. No.: | 16837-52-8 |
| Formula: | C15H24N2O2 |
| Activity: | insecticides (alkaloid) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: | |
| Pronunciation: | ǒks-ǐ-mā-trēn Guide to British pronunciation |
| InChIKey: | XVPBINOPNYFXID-LHDUFFHYSA-N |
| InChI: | InChI=1S/C15H24N2O2/c18-14-7-1-6-13-12-5-3-9-17(19)8-2-4-11(15(12)17)10-16(13)14/h11-13,15H,1-10H2/t11-,12+,13+,15-,17?/m0/s1 |
A data sheet from the Compendium of Pesticide Common Names