| Approval: | China |
|---|---|
| IUPAC PIN: | (5Ξ,7Ξ)-1-[(6-chloropyridin-3-yl)methyl]-7-methyl-8-nitro-5-propoxy-1,2,3,5,6,7-hexahydroimidazo[1,2-a]pyridine |
| IUPAC name: | (5RS,7RS;5RS,7SR)-1-[(6-chloro-3-pyridyl)methyl]-1,2,3,5,6,7-hexahydro-7-methyl-8-nitroimidazo[1,2-a]pyridin-5-yl propyl ether |
| CAS name: | 1-[(6-chloro-3-pyridinyl)methyl]-1,2,3,5,6,7-hexahydro-7-methyl-8-nitro-5-propoxyimidazo[1,2-a]pyridine |
| CAS Reg. No.: | 948994-16-9 |
| Formula: | C17H23ClN4O3 |
| Activity: | insecticides (nitromethylene) |
| Notes: | There is no ISO common name for this substance; the name “paichongding” (哌虫啶) is approved in China. |
| Structure: | |
| Pronunciation: | Guide to British pronunciation |
| InChIKey: | MOTGVPXRLDDMSK-UHFFFAOYSA-N |
| InChI: | InChI=1S/C17H23ClN4O3/c1-3-8-25-15-9-12(2)16(22(23)24)17-20(6-7-21(15)17)11-13-4-5-14(18)19-10-13/h4-5,10,12,15H,3,6-9,11H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names