Status: | ISO 765 (published) |
---|---|
IUPAC name: | copper(II) acetoarsenite or (acetato)trimetaarsenitodicopper |
CAS name: | C.I. Pigment Green 21 |
CAS Reg. No.: | 12002-03-8 |
Formula: | C4H6As6Cu4O16 or Cu(C2H3O2)2·3Cu(AsO2)2 |
Activity: | insecticides (arsenical) molluscicides rodenticides (arsenical) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. In ISO 765-1976 the name “copper acetoarsenite” was given as an alternative. |
Structure: | |
Pronunciation: | pǎr-ǐs grēn Guide to British pronunciation |
InChIKey: | BNKLJOYAQLEMKB-UHFFFAOYSA-J |
InChI: | InChI=1S/C2H4O2.3AsHO2.2Cu/c1-2(3)4;3*2-1-3;;/h1H3,(H,3,4);3*(H,2,3);;/q;;;;2*+2/p-4 |
A data sheet from the Compendium of Pesticide Common Names