| Approval: | ISO common name not required |
|---|---|
| IUPAC name: | copper(II) acetoarsenite or (acetato)trimetaarsenitodicopper |
| CAS name: | C.I. Pigment Green 21 |
| CAS Reg. No.: | 12002-03-8 |
| Formula: | C4H6As6Cu4O16 or Cu(C2H3O2)2·3Cu(AsO2)2 |
| Activity: | insecticides (arsenical) molluscicides rodenticides (arsenical) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name, with the name “copper acetoarsenite” as an alternative. |
| Structure: |  |
| Pronunciation: | pǎr-ǐs grēn Guide to British pronunciation |
| InChIKey: | BNKLJOYAQLEMKB-UHFFFAOYSA-J |
| InChI: | InChI=1S/C2H4O2.3AsHO2.2Cu/c1-2(3)4;3*2-1-3;;/h1H3,(H,3,4);3*(H,2,3);;/q;;;;2*+2/p-4 |