| Approval: | ISO preferred name |
|---|---|
| IUPAC PIN: | nonanoic acid |
| IUPAC name: | nonanoic acid |
| CAS name: | nonanoic acid |
| CAS Reg. No.: | 112-05-0 |
| Formula: | C9H18O2 |
| Activity: | herbicides (aliphatic acid) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: | |
| Pronunciation: | pěl-ar-gǒn-ǐk ǎs-ǐd Guide to British pronunciation |
| InChIKey: | FBUKVWPVBMHYJY-UHFFFAOYSA-N |
| InChI: | InChI=1S/C9H18O2/c1-2-3-4-5-6-7-8-9(10)11/h2-8H2,1H3,(H,10,11) |
A data sheet from the Compendium of Pesticide Common Names