| Approval: | ISO |
|---|---|
| IUPAC PIN: | rac-(2R)-N-(3-chloro-4-methylphenyl)-2-methylpentanamide |
| IUPAC name: | (2RS)-3′-chloro-2,4′-dimethylpentananilide 1979 Rules: (RS)-3′-chloro-2,4′-dimethylvaleranilide |
| CAS name: | N-(3-chloro-4-methylphenyl)-2-methylpentanamide |
| CAS Reg. No.: | 2307-68-8 |
| Formula: | C13H18ClNO |
| Activity: | herbicides (anilide) |
| Notes: | The name “solan” is used in Canada and is approved by the Weed Science Society of America, and the name “CMMP” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
| Structure: | |
| Pronunciation: | pěn-tǎn-ō-klor Guide to British pronunciation |
| InChIKey: | WGVWLKXZBUVUAM-UHFFFAOYSA-N |
| InChI: | InChI=1S/C13H18ClNO/c1-4-5-10(3)13(16)15-11-7-6-9(2)12(14)8-11/h6-8,10H,4-5H2,1-3H3,(H,15,16) |
A data sheet from the Compendium of Pesticide Common Names