| Approval: | ISO common name not required |
|---|---|
| IUPAC PIN: | phenazine 5-oxide |
| IUPAC name: | phenazine 5-oxide |
| CAS name: | phenazine 5-oxide |
| CAS Reg. No.: | 304-81-4 |
| Formula: | C12H8N2O |
| Activity: | bactericides |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: |  |
| Pronunciation: | fěn-a-zēn ǒks-īd Guide to British pronunciation |
| InChIKey: | FFISWZPYNKWIRR-UHFFFAOYSA-N |
| InChI: | InChI=1S/C12H8N2O/c15-14-11-7-3-1-5-9(11)13-10-6-2-4-8-12(10)14/h1-8H |