| Approval: | ISO |
|---|---|
| IUPAC PIN: | 3-[(propan-2-yloxy)formamido]phenyl ethyl(phenyl)carbamate |
| IUPAC name: | 3-[(isopropoxyformyl)amino]phenyl ethyl(phenyl)carbamate 1979 Rules: 3-[(isopropoxycarbonyl)amino]phenyl N-ethylcarbanilate |
| CAS name: | 3-[[(1-methylethoxy)carbonyl]amino]phenyl N-ethyl-N-phenylcarbamate |
| CAS Reg. No.: | 57375-63-0 |
| Formula: | C19H22N2O4 |
| Activity: | herbicides (phenyl carbamate) |
| Notes: | |
| Structure: | |
| Pronunciation: | fěn-īs-ō-fǎm Guide to British pronunciation |
| InChIKey: | PWEOEHNGYFXZLI-UHFFFAOYSA-N |
| InChI: | InChI=1S/C19H22N2O4/c1-4-21(16-10-6-5-7-11-16)19(23)25-17-12-8-9-15(13-17)20-18(22)24-14(2)3/h5-14H,4H2,1-3H3,(H,20,22) |
A data sheet from the Compendium of Pesticide Common Names