| Approval: | ISO preferred name |
|---|---|
| IUPAC PIN: | rac-(5R)-5-(2H-1,3-benzodioxol-5-yl)-3-hexylcyclohex-2-en-1-one |
| IUPAC name: | (5RS)-5-(1,3-benzodioxol-5-yl)-3-hexylcyclohex-2-en-1-one |
| CAS name: | 5-(1,3-benzodioxol-5-yl)-3-hexyl-2-cyclohexen-1-one |
| CAS Reg. No.: | 119-89-1 |
| Formula: | C19H24O3 |
| Activity: | synergists |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: | |
| Pronunciation: | pǐ-pěr-ō-nīl sī-klō-nēn Guide to British pronunciation |
| InChIKey: | JBVNWTXRFKZNBQ-UHFFFAOYSA-N |
| InChI: | InChI=1S/C19H24O3/c1-2-3-4-5-6-14-9-16(11-17(20)10-14)15-7-8-18-19(12-15)22-13-21-18/h7-8,10,12,16H,2-6,9,11,13H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names