| Approval: | none |
|---|---|
| IUPAC PIN: | 6,7-dimethoxy-2,2-dimethyl-2H-1-benzopyran |
| IUPAC name: | 6,7-dimethoxy-2,2-dimethyl-2H-chromene |
| CAS name: | 6,7-dimethoxy-2,2-dimethyl-2H-1-benzopyran |
| CAS Reg. No.: | 644-06-4 |
| Formula: | C13H16O3 |
| Activity: | insecticides (precocene) |
| Notes: | There is no ISO common name for this substance; the name “precocene II” has been used in the literature but it has no official approval. |
| Structure: | |
| Pronunciation: | prǐ-kō-sēn too Guide to British pronunciation |
| InChIKey: | PTIDGSWTMLSGAH-UHFFFAOYSA-N |
| InChI: | InChI=1S/C13H16O3/c1-13(2)6-5-9-7-11(14-3)12(15-4)8-10(9)16-13/h5-8H,1-4H3 |
A data sheet from the Compendium of Pesticide Common Names