| Approval: | ISO | 
|---|---|
| IUPAC PIN: | (5Ξ)-2-{(1Ξ)-N-[(2Ξ)-2-(4-chlorophenoxy)propoxy]butanimidoyl}-3-hydroxy-5-[(3Ξ)-thian-3-yl]cyclohex-2-en-1-one | 
| IUPAC name: | (5RS)-2-((EZ)-1-{[(2RS)-2-(4-chlorophenoxy)propoxy]imino}butyl)-3-hydroxy-5-[(3RS)-thian-3-yl]cyclohex-2-en-1-one | 
| CAS name: | 2-[1-[[2-(4-chlorophenoxy)propoxy]imino]butyl]-3-hydroxy-5-(tetrahydro-2H-thiopyran-3-yl)-2-cyclohexen-1-one | 
| CAS Reg. No.: | 139001-49-3 | 
| Formula: | C24H32ClNO4S | 
| Activity: | herbicides (cyclohexanedione oxime) | 
| Notes: | The name “clefoxydim” has been used in the literature, but it has no official approval. | 
| Structure: | |
| Pronunciation: | prō-fǒk-sē-dǐm Guide to British pronunciation | 
| InChIKey: | KRQUFUKTQHISJB-UHFFFAOYSA-N | 
| InChI: | InChI=1/C24H32ClNO4S/c1-3-5-21(26-29-14-16(2)30-20-9-7-19(25)8-10-20)24-22(27)12-18(13-23(24)28)17-6-4-11-31-15-17/h7-10,16-18,27H,3-6,11-15H2,1-2H3 | 
A data sheet from the Compendium of Pesticide Common Names