| Approval: | China |
|---|---|
| IUPAC PIN: | (1Ξ)-3-(3,4-dichlorophenyl)triaz-1-ene-1-carbothioamide |
| IUPAC name: | (1EZ)-3-(3,4-dichlorophenyl)triaz-1-ene-1-carbothioamide or (EZ)-[(3,4-dichlorophenyl)diazo]thiourea |
| CAS name: | 3-(3,4-dichlorophenyl)-1-triazene-1-carbothioamide |
| CAS Reg. No.: | 5836-73-7 |
| Formula: | C7H6Cl2N4S |
| Activity: | rodenticides (thiourea) |
| Notes: | There is no ISO common name for this substance; the name “promurit” (灭鼠肼) is approved in China, even though Promurit is (or was) a registered trade mark in many countries. |
| Structure: |  |
| Pronunciation: | prō-mūr-ǐt Guide to British pronunciation |
| InChIKey: | BOQUJWASRWDQOS-UHFFFAOYSA-N |
| InChI: | InChI=1S/C7H6Cl2N4S/c8-5-2-1-4(3-6(5)9)11-13-12-7(10)14/h1-3H,(H3,10,11,12,14) |