| Approval: | ISO | 
|---|---|
| IUPAC PIN: | propan-2-yl phenylcarbamate | 
| IUPAC name: | isopropyl phenylcarbamate 1979 Rules: isopropyl carbanilate | 
| CAS name: | 1-methylethyl N-phenylcarbamate | 
| CAS Reg. No.: | 122-42-9 | 
| Formula: | C10H13NO2 | 
| Activity: | herbicides (carbamate) plant growth regulators (growth inhibitor) | 
| Notes: | The name “IPC” (ИФК) was used in the former USSR. | 
| Structure: | |
| Pronunciation: | prō-fǎm Guide to British pronunciation | 
| InChIKey: | VXPLXMJHHKHSOA-UHFFFAOYSA-N | 
| InChI: | InChI=1S/C10H13NO2/c1-8(2)13-10(12)11-9-6-4-3-5-7-9/h3-8H,1-2H3,(H,11,12) | 
A data sheet from the Compendium of Pesticide Common Names