| Approval: | ISO |
|---|---|
| IUPAC PIN: | propan-2-yl phenylcarbamate |
| IUPAC name: | isopropyl phenylcarbamate 1979 Rules: isopropyl carbanilate |
| CAS name: | 1-methylethyl N-phenylcarbamate |
| CAS Reg. No.: | 122-42-9 |
| Formula: | C10H13NO2 |
| Activity: | herbicides (carbamate) plant growth regulators (growth inhibitor) |
| Notes: | The name “IPC” (ИФК) was used in the former USSR. |
| Structure: | |
| Pronunciation: | prō-fǎm Guide to British pronunciation |
| InChIKey: | VXPLXMJHHKHSOA-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H13NO2/c1-8(2)13-10(12)11-9-6-4-3-5-7-9/h3-8H,1-2H3,(H,11,12) |
A data sheet from the Compendium of Pesticide Common Names