Status: | ISO 765 (published) |
---|---|
IUPAC PIN: | dipropyl (5Ξ,6Ξ,7Ξ)-7-methyl-5,6,7,8-tetrahydro-2H-naphtho[2,3-d][1,3]dioxole-5,6-dicarboxylate |
IUPAC name: | dipropyl (5RS,6RS,7RS)-5,6,7,8-tetrahydro-7-methylnaphtho[2,3-d]-1,3-dioxole-5,6-dicarboxylate or dipropyl (1RS,2RS,3RS)-1,2,3,4-tetrahydro-3-methyl-6,7-methylenedioxynaphthalene-1,2-dicarboxylate |
CAS name: | dipropyl 5,6,7,8-tetrahydro-7-methylnaphtho[2,3-d]-1,3-dioxole-5,6-dicarboxylate |
CAS Reg. No.: | 83-59-0 |
Formula: | C20H26O6 |
Activity: | synergists |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | prō-pīl ī-sōm Guide to British pronunciation |
InChIKey: | UEKQGZQLUMSLNW-UHFFFAOYSA-N |
InChI: | InChI=1S/C20H26O6/c1-4-6-23-19(21)17-12(3)8-13-9-15-16(26-11-25-15)10-14(13)18(17)20(22)24-7-5-2/h9-10,12,17-18H,4-8,11H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names