| Approval: | ISO |
|---|---|
| IUPAC PIN: | N-(4-nitrophenyl)-N′-(pyridin-3-ylmethyl)urea |
| IUPAC name: | 1-(4-nitrophenyl)-3-(3-pyridylmethyl)urea |
| CAS name: | N-(4-nitrophenyl)-N′-(3-pyridinylmethyl)urea |
| CAS Reg. No.: | 53558-25-1 |
| Formula: | C13H12N4O3 |
| Activity: | rodenticides (unclassified) |
| Notes: | The name “piriminil” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
| Structure: | |
| Pronunciation: | pǐ-rǐ-nūr-ǒn Guide to British pronunciation |
| InChIKey: | CLKZWXHKFXZIMA-UHFFFAOYSA-N |
| InChI: | InChI=1S/C13H12N4O3/c18-13(15-9-10-2-1-7-14-8-10)16-11-3-5-12(6-4-11)17(19)20/h1-8H,9H2,(H2,15,16,18) |
A data sheet from the Compendium of Pesticide Common Names