| Approval: | ISO | 
|---|---|
| IUPAC PIN: | 2-amino-3-chloronaphthalene-1,4-dione | 
| IUPAC name: | 2-amino-3-chloro-1,4-naphthoquinone | 
| CAS name: | 2-amino-3-chloro-1,4-naphthalenedione | 
| CAS Reg. No.: | 2797-51-5 | 
| Formula: | C10H6ClNO2 | 
| Activity: | algicides herbicides (quinone) | 
| Notes: | The name “ACN” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. | 
| Structure: | |
| Pronunciation: | kwǐn-ō-kla-mēn Guide to British pronunciation | 
| InChIKey: | OBLNWSCLAYSJJR-UHFFFAOYSA-N | 
| InChI: | InChI=1S/C10H6ClNO2/c11-7-8(12)10(14)6-4-2-1-3-5(6)9(7)13/h1-4H,12H2 | 
A data sheet from the Compendium of Pesticide Common Names