| Approval: | China |
|---|---|
| IUPAC PIN: | dipropyl pyridine-2,5-dicarboxylate |
| IUPAC name: | dipropyl pyridine-2,5-dicarboxylate or di-n-propyl isocinchomeronate |
| CAS name: | dipropyl 2,5-pyridinedicarboxylate |
| CAS Reg. No.: | 136-45-8 |
| Formula: | C13H17NO4 |
| Activity: | insect repellents |
| Notes: | There is no ISO common name for this substance; the name “quyingding” (驱蝇啶) is approved in China. |
| Structure: | |
| Pronunciation: | Guide to British pronunciation |
| InChIKey: | IITCWRFYJWUUPC-UHFFFAOYSA-N |
| InChI: | InChI=1S/C13H17NO4/c1-3-7-17-12(15)10-5-6-11(14-9-10)13(16)18-8-4-2/h5-6,9H,3-4,7-8H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names