| Status: | ISO 1750 (approved) |
|---|---|
| IUPAC PIN: | mixture of 55–45% (3S,6R)-3-methyl-6-(prop-1-en-2-yl)dec-9-en-1-yl acetate and 45–55% (3S,6S)-3-methyl-6-(prop-1-en-2-yl)dec-9-en-1-yl acetate |
| IUPAC name: | mixture of 55–45% (3S,6R)-6-isopropenyl-3-methyldec-9-en-1-yl acetate and 45–55% (3S,6S)-6-isopropenyl-3-methyldec-9-en-1-yl acetate 1979 Rules: mixture of 55–45% (3S,6R)-6-isopropenyl-3-methyldec-9-enyl acetate and 45–55% (3S,6S)-6-isopropenyl-3-methyldec-9-enyl acetate |
| CAS name: | (3S)-3-methyl-6-(1-methylethenyl)-9-decen-1-yl acetate |
| CAS Reg. No.: | 64309-03-1 |
| Formula: | C16H28O2 |
| Activity: | insect attractants (Homopteran) |
| Notes: | The name “rescalure” was originally wrongly applied to any mixture of the four possible diastereoisomers, and the definition was corrected in June 2017. |
| Structure: |  |
| Pronunciation: | rěs-ka-lūr Guide to British pronunciation |
| InChIKey: | UJJKWQRTTYLTQL-LBAUFKAWSA-N |
| InChI: | InChI=1S/C16H28O2/c1-6-7-8-16(13(2)3)10-9-14(4)11-12-18-15(5)17/h6,14,16H,1-2,7-12H2,3-5H3/t14-,16?/m0/s1 |