| Approval: | ISO |
|---|---|
| IUPAC PIN: | 5-chloro-2-{3-chloro-2-[3-(difluoromethyl)-1,2-oxazol-5-yl]phenoxy}pyrimidine |
| IUPAC name: | 3-chloro-2-[3-(difluoromethyl)isoxazol-5-yl]phenyl 5-chloropyrimidin-2-yl ether |
| CAS name: | 5-chloro-2-[3-chloro-2-[3-(difluoromethyl)-5-isoxazolyl]phenoxy]pyrimidine |
| CAS Reg. No.: | 1801862-02-1 |
| Formula: | C14H7Cl2F2N3O2 |
| Activity: | herbicides (unclassified) |
| Notes: | |
| Structure: | |
| Pronunciation: | rǐm-īs-ǒks-a-fěn Guide to British pronunciation |
| InChIKey: | SOZRVJLJEGLPGH-UHFFFAOYSA-N |
| InChI: | InChI=1S/C14H7Cl2F2N3O2/c15-7-5-19-14(20-6-7)22-10-3-1-2-8(16)12(10)11-4-9(13(17)18)21-23-11/h1-6,13H |
A data sheet from the Compendium of Pesticide Common Names