| Approval: | none |
|---|---|
| IUPAC PIN: | prop-2-yn-1-yl (2E,4E,7S)-3,7,11-trimethyldodeca-2,4-dienoate |
| IUPAC name: | prop-2-ynyl (E,E)-(S)-3,7,11-trimethyldodeca-2,4-dienoate |
| CAS name: | 2-propyn-1-yl (2E,4E,7S)-3,7,11-trimethyl-2,4-dodecadienoate |
| CAS Reg. No.: | 65733-20-2 |
| Formula: | C18H28O2 |
| Activity: | insecticides (juvenile hormone mimic) |
| Notes: | The name “S-kinoprene” is used in the literature for this isomer, which has been used commercically, but it has no official approval. The racemic mixture [42588-37-4] has the ISO common name "kinoprene". |
| Structure: |  |
| Pronunciation: | Guide to British pronunciation |
| InChIKey: | FZRBKIRIBLNOAM-PBGROSLGSA-N |
| InChI: | InChI=1S/C18H28O2/c1-6-13-20-18(19)14-17(5)12-8-11-16(4)10-7-9-15(2)3/h1,8,12,14-16H,7,9-11,13H2,2-5H3/b12-8+,17-14+/t16-/m0/s1 |