| Approval: | ISO |
|---|---|
| IUPAC PIN: | reaction mixture of 80–100% 2-chloro-N-(2-ethyl-6-methylphenyl)-N-[(2S)-1-methoxypropan-2-yl]acetamide and 20–0% 2-chloro-N-(2-ethyl-6-methylphenyl)-N-[(2R)-1-methoxypropan-2-yl]acetamide |
| IUPAC name: | reaction mixture of 80–100% 2-chloro-2′-ethyl-N-[(1S)-2-methoxy-1-methylethyl]-6′-methylacetanilide and 20–0% 2-chloro-2′-ethyl-N-[(1R)-2-methoxy-1-methylethyl]-6′-methylacetanilide |
| CAS name: | 2-chloro-N-(2-ethyl-6-methylphenyl)-N-[(1S)-2-methoxy-1-methylethyl]acetamide |
| CAS Reg. No.: | 87392-12-9 |
| Formula: | C15H22ClNO2 |
| Activity: | herbicides (chloroacetamide) |
| Notes: | The unresolved substance has the ISO common name metolachlor. |
| Structure: | |
| Pronunciation: | ěs mě-tǒl-a-klor Guide to British pronunciation |
| InChIKey: | major component (S)-isomer: WVQBLGZPHOPPFO-LBPRGKRZSA-N minor component (R)-isomer: WVQBLGZPHOPPFO-GFCCVEGCSA-N |
| InChI: | major component (S)-isomer: InChI=1S/C15H22ClNO2/c1-5-13-8-6-7-11(2)15(13)17(14(18)9-16)12(3)10-19-4/h6-8,12H,5,9-10H2,1-4H3/t12-/m0/s1 minor component (R)-isomer: InChI=1S/C15H22ClNO2/c1-5-13-8-6-7-11(2)15(13)17(14(18)9-16)12(3)10-19-4/h6-8,12H,5,9-10H2,1-4H3/t12-/m1/s1 |
A data sheet from the Compendium of Pesticide Common Names