| Approval: | ISO common name not required |
|---|---|
| IUPAC name: | sodium chlorate |
| CAS name: | sodium chlorate |
| CAS Reg. No.: | 7775-09-9 |
| Formula: | ClNaO3 |
| Activity: | herbicides (inorganic) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: | |
| Pronunciation: | sō-dē-am klor-āt Guide to British pronunciation |
| InChIKey: | YZHUMGUJCQRKBT-UHFFFAOYSA-M |
| InChI: | InChI=1S/ClHO3.Na/c2-1(3)4;/h(H,2,3,4);/q;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names