Status: | ISO 765 (published) |
---|---|
IUPAC PIN: | sodium fluoroacetate |
IUPAC name: | sodium fluoroacetate |
CAS name: | sodium 2-fluoroacetate |
CAS Reg. No.: | 62-74-8 |
Formula: | C2H2FNaO2 |
Activity: | rodenticides (halogenated alkanoic acid) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. The parent acid, fluoroacetic acid [144-49-0], is also considered not to require a common name. |
Structure: | |
Pronunciation: | sō-dē-am floo-a-rō-ǎs-ǐ-tāt Guide to British pronunciation |
InChIKey: | JGFYQVQAXANWJU-UHFFFAOYSA-M |
InChI: | InChI=1S/C2H3FO2.Na/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names