| Approval: | ISO |
|---|---|
| IUPAC name: | bridged fused ring systems nomenclature: mixture of 50–90% 3'-O-ethyl 5,6-dihydro spinosyn J: (2R,3aR,5aR,5bS,9S,13S,14R,16aS,16bR)-2-[(6-deoxy-3-O-ethyl-2,4-di-O-methyl-α-L-mannopyranosyl)oxy]-13-{[(2R,5S,6R)-5-(dimethylamino)tetrahydro-6-methylpyran-2-yl]oxy}-9-ethyl-2,3,3a,4,5,5a,5b,6,9,10,11,12,13,14,16a,16b-hexadecahydro-14-methyl-1H-as-indaceno[3,2-d]oxacyclododecine-7,15-dione and 50–10% 3'-O-ethyl spinosyn L: :(2S,3aR,5aS,5bS,9S,13S,14R,16aS,16bS)-2-[(6-deoxy-3-O-ethyl-2,4-di-O-methyl-α-L-mannopyranosyl)oxy]-13-{[(2R,5S,6R)-5-(dimethylamino)tetrahydro-6-methylpyran-2-yl]oxy}-9-ethyl-2,3,3a,5a,5b,6,9,10,11,12,13,14,16a,16b-tetradecahydro-4,14-dimethyl-1H-as-indaceno[3,2-d]oxacyclododecine-7,15-dione or extended von Baeyer nomenclature: mixture of 50–90% 3'-O-ethyl 5,6-dihydro spinosyn J: (1S,2R,5R,7R,9R,10S,14R,15S,19S)-7-[(6-deoxy-3-O-ethyl-2,4-di-O-methyl-α-L-mannopyranosyl)oxy]-15-{[(2R,5S,6R)-5-(dimethylamino)tetrahydro-6-methylpyran-2-yl]oxy}-19-ethyl-14-methyl-20-oxatetracyclo[10.10.0.02,10.05,9]docos-11-ene-13,21-dione and 50–10% 3'-O-ethyl spinosyn L: (1S,2S,5R,7S,9S,10S,14R,15S,19S)-7-[(6-deoxy-3-O-ethyl-2,4-di-O-methyl-α-L-mannopyranosyl)oxy]-15-{[(2R,5S,6R)-5-(dimethylamino)tetrahydro-6-methylpyran-2-yl]oxy}-19-ethyl-4,14-dimethyl-20-oxatetracyclo[10.10.0.02,10.05,9]docosa-3,11-diene-13,21-dione |
| CAS name: | (3'-O-ethyl 5,6-dihydro spinosyn J): (2R,3aR,5aR,5bS,9S,13S,14R,16aS,16bR)-2-[(6-deoxy-3-O-ethyl-2,4-di-O-methyl-α-L-mannopyranosyl)oxy]-13-[[(2R,5S,6R)-5-(dimethylamino)tetrahydro-6-methyl-2H-pyran-2-yl]oxy]-9-ethyl-2,3,3a,4,5,5a,5b,6,9,10,11,12,13,14,16a,16b-hexadecahydro-14-methyl-1H-as-indaceno[3,2-d]oxacyclododecin-7,15-dione mixture with (3'-O-ethyl spinosyn L): (2S,3aR,5aS,5bS,9S,13S,14R,16aS,16bS)-2-[(6-deoxy-3-O-ethyl-2,4-di-O-methyl-α-L-mannopyranosyl)oxy]-13-[[(2R,5S,6R)-5-(dimethylamino)tetrahydro-6-methyl-2H-pyran-2-yl]oxy]-9-ethyl-2,3,3a,5a,5b,6,9,10,11,12,13,14,16a,16b-tetradecahydro-4,14-dimethyl-1H-as-indaceno[3,2-d]oxacyclododecin-7,15-dione |
| CAS Reg. No.: | 935545-74-7 |
| Formula: | C42H69NO10 + C43H69NO10 |
| Activity: | insecticides (spinosyn) |
| Notes: | A mixture of 50-90% 3'-O-ethyl 5,6-dihydro spinosyn J and 10-50% 3'-O-ethyl spinosyn L. The CAS Registry Numbers of the components are 187166-40-1 (major component) and 187166-15-0 (minor component). |
| Structure: | |
| Pronunciation: | spī-nět-ō-rǎm Guide to British pronunciation |
| InChIKey: | major component 3'-O<-ethyl 5,6-dihydro spinosyn J: GOENIMGKWNZVDA-RWGFPKGXSA-N minor component 3'-O-ethyl spinosyn L: KWVYSEWJJXXTEZ-GDMNSMANSA-N |
| InChI: | major component 3'--ethyl 5,6-dihydro spinosyn J: InChI=1S/C42H69NO10/c1-10-27-13-12-14-35(53-37-18-17-34(43(6)7)24(4)49-37)23(3)38(45)33-21-31-29(32(33)22-36(44)51-27)16-15-26-19-28(20-30(26)31)52-42-41(47-9)40(48-11-2)39(46-8)25(5)50-42/h21,23-32,34-35,37,39-42H,10-20,22H2,1-9H3/t23-,24-,25+,26-,27+,28-,29-,30-,31-,32+,34+,35+,37+,39+,40-,41-,42+/m1/s1 minor component 3'-O-ethyl spinosyn L: InChI=1S/C43H69NO10/c1-11-27-14-13-15-36(54-38-17-16-35(44(7)8)25(5)50-38)24(4)39(46)34-21-32-30(33(34)22-37(45)52-27)18-23(3)29-19-28(20-31(29)32)53-43-42(48-10)41(49-12-2)40(47-9)26(6)51-43/h18,21,24-33,35-36,38,40-43H,11-17,19-20,22H2,1-10H3/t24-,25-,26+,27+,28-,29+,30-,31-,32-,33+,35+,36+,38+,40+,41-,42-,43+/m1/s1 |
A data sheet from the Compendium of Pesticide Common Names