| Approval: | ISO |
|---|---|
| IUPAC PIN: | (5s,8s)-3-(2,5-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl ethyl carbonate |
| IUPAC name: | cis-3-(2,5-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl ethyl carbonate 1979 Rules: ethyl cis-8-methoxy-2-oxo-3-(2,5-xylyl)-1-azaspiro[4.5]dec-3-en-4-yl carbonate |
| CAS name: | cis-3-(2,5-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl ethyl carbonate |
| CAS Reg. No.: | 203313-25-1 |
| Formula: | C21H27NO5 |
| Activity: | insecticides (tetramic acid) |
| Notes: | |
| Structure: | |
| Pronunciation: | spīr-ō-tět-ra-mǎt Guide to British pronunciation |
| InChIKey: | CLSVJBIHYWPGQY-GGYDESQDSA-N |
| InChI: | InChI=1S/C21H27NO5/c1-5-26-20(24)27-18-17(16-12-13(2)6-7-14(16)3)19(23)22-21(18)10-8-15(25-4)9-11-21/h6-7,12,15H,5,8-11H2,1-4H3,(H,22,23)/t15-,21+ |
A data sheet from the Compendium of Pesticide Common Names