| Approval: | ISO |
|---|---|
| IUPAC PIN: | methyl (3,4-dichlorophenyl)carbamate |
| IUPAC name: | methyl (3,4-dichlorophenyl)carbamate 1979 Rules: methyl 3,4-dichlorocarbanilate |
| CAS name: | methyl N-(3,4-dichlorophenyl)carbamate |
| CAS Reg. No.: | 1918-18-9 |
| Formula: | C8H7Cl2NO2 |
| Activity: | herbicides (carbamate) |
| Notes: | Name is approved by the American National Standards Institute, the Weed Science Society of America and in China (灭草灵). The name “MCC” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
| Structure: |  |
| Pronunciation: | swěp Guide to British pronunciation |
| InChIKey: | WOZQBERUBLYCEG-UHFFFAOYSA-N |
| InChI: | InChI=1S/C8H7Cl2NO2/c1-13-8(12)11-5-2-3-6(9)7(10)4-5/h2-4H,1H3,(H,11,12) |