| Approval: | ISO |
|---|---|
| IUPAC PIN: | 1,1′-(2,2-dichloroethane-1,1-diyl)bis(4-chlorobenzene) |
| IUPAC name: | 1,1-dichloro-2,2-bis(4-chlorophenyl)ethane |
| CAS name: | 1,1′-(2,2-dichloroethylidene)bis[4-chlorobenzene] |
| CAS Reg. No.: | 72-54-8 |
| Formula: | C14H10Cl4 |
| Activity: | insecticides (organochlorine) |
| Notes: | The name “DDD” has been used in the literature, but it has no official approval. |
| Structure: | |
| Pronunciation: | tē dē ē Guide to British pronunciation |
| InChIKey: | AHJKRLASYNVKDZ-UHFFFAOYSA-N |
| InChI: | InChI=1S/C14H10Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8,13-14H |
A data sheet from the Compendium of Pesticide Common Names