| Approval: | ISO common name not required |
|---|---|
| IUPAC PIN: | 1,1,2,2-tetrachloroethane |
| IUPAC name: | 1,1,2,2-tetrachloroethane |
| CAS name: | 1,1,2,2-tetrachloroethane |
| CAS Reg. No.: | 79-34-5 |
| Formula: | C2H2Cl4 |
| Activity: | insecticides (alkyl halide; fumigant) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: | |
| Pronunciation: | tě-tra-klor-ō-ē-thān Guide to British pronunciation |
| InChIKey: | QPFMBZIOSGYJDE-UHFFFAOYSA-N |
| InChI: | InChI=1S/C2H2Cl4/c3-1(4)2(5)6/h1-2H |
A data sheet from the Compendium of Pesticide Common Names