| Approval: | China |
|---|---|
| IUPAC PIN: | 4,4-dimethylmorpholin-4-ium chloride |
| IUPAC name: | 4,4-dimethylmorpholin-4-ium chloride |
| CAS name: | 4,4-dimethylmorpholinium chloride |
| CAS Reg. No.: | 23165-19-7 |
| Formula: | C6H14ClNO |
| Activity: | plant growth regulators (growth inhibitor) |
| Notes: | There is no ISO common name for this substance; the name “tiaojiean” (调节安) is approved in China. |
| Structure: | |
| Pronunciation: | Guide to British pronunciation |
| InChIKey: | RBIPMCDRANHGQI-UHFFFAOYSA-M |
| InChI: | InChI=1S/C6H14NO.ClH/c1-7(2)3-5-8-6-4-7;/h3-6H2,1-2H3;1H/q+1;/p-1 |
A data sheet from the Compendium of Pesticide Common Names