Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | S-(2,3,3-trichloroprop-2-en-1-yl) di(propan-2-yl)carbamothioate |
IUPAC name: | S-(2,3,3-trichloroallyl) diisopropylcarbamothioate 1979 Rules: S-(2,3,3-trichloroallyl) diisopropyl(thiocarbamate) |
CAS name: | S-(2,3,3-trichloro-2-propen-1-yl) N,N-bis(1-methylethyl)carbamothioate |
CAS Reg. No.: | 2303-17-5 |
Formula: | C10H16Cl3NOS |
Activity: | herbicides (thiocarbamate) |
Notes: | The name “triallate” is approved by the Weed Science Society of America. |
Structure: | |
Pronunciation: | trī-ǎl-āt Guide to British pronunciation |
InChIKey: | MWBPRDONLNQCFV-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H16Cl3NOS/c1-6(2)14(7(3)4)10(15)16-5-8(11)9(12)13/h6-7H,5H2,1-4H3 |
A data sheet from the Compendium of Pesticide Common Names