| Approval: | ISO |
|---|---|
| IUPAC PIN: | 2,3,5-trichloro-6-methoxybenzoic acid |
| IUPAC name: | 2,3,5-trichloro-6-methoxybenzoic acid 1979 Rules: 3,5,6-trichloro-o-anisic acid |
| CAS name: | 2,3,5-trichloro-6-methoxybenzoic acid |
| CAS Reg. No.: | 2307-49-5 |
| Formula: | C8H5Cl3O3 |
| Activity: | herbicides (benzoic acid) |
| Notes: | |
| Structure: | |
| Pronunciation: | trī-kǎm-ba Guide to British pronunciation |
| InChIKey: | WCLDITPGPXSPGV-UHFFFAOYSA-N |
| InChI: | InChI=1S/C8H5Cl3O3/c1-14-7-4(10)2-3(9)6(11)5(7)8(12)13/h2H,1H3,(H,12,13) |
A data sheet from the Compendium of Pesticide Common Names