| Approval: | ISO |
|---|---|
| IUPAC PIN: | 6-chloro-N2,N2,N4-triethyl-1,3,5-triazine-2,4-diamine |
| IUPAC name: | 6-chloro-N2,N2,N4-triethyl-1,3,5-triazine-2,4-diamine |
| CAS name: | 6-chloro-N2,N2,N4-triethyl-1,3,5-triazine-2,4-diamine |
| CAS Reg. No.: | 1912-26-1 |
| Formula: | C9H16ClN5 |
| Activity: | herbicides (chlorotriazine) |
| Notes: | |
| Structure: | |
| Pronunciation: | trī-ět-a-zēn Guide to British pronunciation |
| InChIKey: | HFBWPRKWDIRYNX-UHFFFAOYSA-N |
| InChI: | InChI=1S/C9H16ClN5/c1-4-11-8-12-7(10)13-9(14-8)15(5-2)6-3/h4-6H2,1-3H3,(H,11,12,13,14) |
A data sheet from the Compendium of Pesticide Common Names