| Approval: | ISO |
|---|---|
| IUPAC PIN: | rac-4-hydroxy-3-[(1R)-3-oxo-1-phenylbutyl]-2H-1-benzopyran-2-one |
| IUPAC name: | 4-hydroxy-3-[(1RS)-3-oxo-1-phenylbutyl]-2H-chromen-2-one 1979 Rules: 4-hydroxy-3-[(RS)-3-oxo-1-phenylbutyl]coumarin |
| CAS name: | 4-hydroxy-3-(3-oxo-1-phenylbutyl)-2H-1-benzopyran-2-one |
| CAS Reg. No.: | 81-81-2 |
| Formula: | C19H16O4 |
| Activity: | rodenticides (coumarin) |
| Notes: | * The name “coumafène” (n.m.) is used in France, but the ISO common name also appears to be used. The name “warfarin” is approved by the World Health Organization; the Chinese version is “华法林”. The name “zoocoumarin” (зоокумарин) was used in the former USSR. Derivatives include warfarin-potassium [2610-86-8], warfarin-sodium [129-06-6]. |
| Structure: | |
| Pronunciation: | wor-fa-rǐn Guide to British pronunciation |
| InChIKey: | PJVWKTKQMONHTI-UHFFFAOYSA-N |
| InChI: | InChI=1S/C19H16O4/c1-12(20)11-15(13-7-3-2-4-8-13)17-18(21)14-9-5-6-10-16(14)23-19(17)22/h2-10,15,21H,11H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names