2,5-dichlorobenzoic acid

Chinese:   French:   Russian:


Approval: none
IUPAC PIN: 2,5-dichlorobenzoic acid
IUPAC name: 2,5-dichlorobenzoic acid
CAS name: 2,5-dichlorobenzoic acid
CAS Reg. No.: 50-79-3
Formula: C7H4Cl2O2
Activity: fungicides (unclassified)
plant growth regulators (unclassified)
Notes: There is no ISO common name for this substance. Derivatives include methyl 2,5-dichlorobenzoate [2905-69-3]
Structure: Structural formula of 2,5-dichlorobenzoic acid
Pronunciation:  Guide to British pronunciation
InChIKey: QVTQYSFCFOGITD-UHFFFAOYSA-N
InChI: InChI=1S/C7H4Cl2O2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H,10,11)

A data sheet from the Compendium of Pesticide Common Names