| Approval: | ISO common name not required |
|---|---|
| IUPAC PIN: | [1,1′-biphenyl]-2-ol |
| IUPAC name: | biphenyl-2-ol |
| CAS name: | [1,1′-biphenyl]-2-ol |
| CAS Reg. No.: | 90-43-7 |
| Formula: | C12H10O |
| Activity: | fungicides (phenol) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. The Chinese name “联苯酚” has also been used in the literature, but it has no official approval. Derivatives include sodium o-phenylphenoxide [132-27-4]. |
| Structure: |  |
| Pronunciation: | too fē-nīl-fē-nǒl Guide to British pronunciation |
| InChIKey: | LLEMOWNGBBNAJR-UHFFFAOYSA-N |
| InChI: | InChI=1S/C12H10O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9,13H |