| Approval: | ISO |
|---|---|
| IUPAC PIN: | (4-chlorophenoxy)acetic acid |
| IUPAC name: | (4-chlorophenoxy)acetic acid |
| CAS name: | 2-(4-chlorophenoxy)acetic acid |
| CAS Reg. No.: | 122-88-3 |
| Formula: | C8H7ClO3 |
| Activity: | herbicides (phenoxyacetic) plant growth regulators (auxin) |
| Notes: | The name “4-ChFU” (4-ХФУ) was used in the former USSR. Derivatives include 4-CPA-diolamine [53404-23-2], 4-CPA-potassium [67433-96-9], 4-CPA-sodium [13730-98-8]. |
| Structure: | |
| Pronunciation: | for sē pē ā Guide to British pronunciation |
| InChIKey: | SODPIMGUZLOIPE-UHFFFAOYSA-N |
| InChI: | InChI=1S/C8H7ClO3/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2,(H,10,11) |
A data sheet from the Compendium of Pesticide Common Names