| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | (4-chlorophenoxy)acetic acid—2,2′-azanediyldi(ethan-1-ol) (1/1) |
| IUPAC name: | (4-chlorophenoxy)acetic acid - 2,2′-iminodiethanol (1:1) or bis(2-hydroxyethyl)ammonium (4-chlorophenoxy)acetate |
| CAS name: | 2-(4-chlorophenoxy)acetic acid compound with 2,2′-iminobis[ethanol] (1:1) |
| CAS Reg. No.: | 53404-23-2 |
| Formula: | C12H18ClNO5 |
| Activity: | herbicides (phenoxyacetic) plant growth regulators (auxin) |
| Notes: | This substance is a derivative of 4-CPA [122-88-3]. |
| Structure: |  |
| Pronunciation: | for sē pē ā dī-ǒl-a-mēn Guide to British pronunciation |
| InChIKey: | WVWKBBSRDNKDIX-UHFFFAOYSA-N |
| InChI: | InChI=1S/C8H7ClO3.C4H11NO2/c9-6-1-3-7(4-2-6)12-5-8(10)11;6-3-1-5-2-4-7/h1-4H,5H2,(H,10,11);5-7H,1-4H2 |