Approval: | ISO common name not required |
---|---|
IUPAC name: | phenylmercury(II) quinolin-8-olate or phenylmercury(2+) quinolin-8-olate or phenylmercuric quinolin-8-olate |
CAS name: | phenyl(8-quinolinolato-κO)mercury |
CAS Reg. No.: | 14354-56-4 |
Formula: | C15H11HgNO |
Activity: | fungicides (mercury compound) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | āt fē-nīl-mer-kūr-ē-ǒk-sē-kwǐn-a-lēn Guide to British pronunciation |
InChIKey: | FSRHNWZLCJXDBK-UHFFFAOYSA-M |
InChI: | InChI=1S/C9H7NO.C6H5.Hg/c11-8-5-1-3-7-4-2-6-10-9(7)8;1-2-4-6-5-3-1;/h1-6,11H;1-5H;/q;;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names