| Approval: | ISO common name not required |
|---|---|
| IUPAC name: | phenylmercury(II) quinolin-8-olate or phenylmercury(2+) quinolin-8-olate or phenylmercuric quinolin-8-olate |
| CAS name: | phenyl(8-quinolinolato-κO)mercury |
| CAS Reg. No.: | 14354-56-4 |
| Formula: | C15H11HgNO |
| Activity: | fungicides (mercury compound) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: |  |
| Pronunciation: | āt fē-nīl-mer-kūr-ē-ǒk-sē-kwǐn-a-lēn Guide to British pronunciation |
| InChIKey: | FSRHNWZLCJXDBK-UHFFFAOYSA-M |
| InChI: | InChI=1S/C9H7NO.C6H5.Hg/c11-8-5-1-3-7-4-2-6-10-9(7)8;1-2-4-6-5-3-1;/h1-6,11H;1-5H;/q;;+1/p-1 |