Status: | ISO 765 (published) |
---|---|
IUPAC PIN: | S-prop-2-en-1-yl prop-2-ene-1-sulfinothioate |
IUPAC name: | S-allyl prop-2-ene-1-sulfinothioate |
CAS name: | S-2-propen-1-yl 2-propene-1-sulfinothioate |
CAS Reg. No.: | 539-86-6 |
Formula: | C6H10OS2 |
Activity: | fungicides (botanical) insecticides (botanical) molluscicides |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | ǎl-ǐ-sǐn Guide to British pronunciation |
InChIKey: | JDLKFOPOAOFWQN-UHFFFAOYSA-N |
InChI: | InChI=1S/C6H10OS2/c1-3-5-8-9(7)6-4-2/h3-4H,1-2,5-6H2 |
A data sheet from the Compendium of Pesticide Common Names