| Approval: | ISO |
|---|---|
| IUPAC PIN: | (4-chloro-2-oxo-1,3-benzothiazol-3(2H)-yl)acetic acid |
| IUPAC name: | (4-chloro-2,3-dihydro-2-oxo-1,3-benzothiazol-3-yl)acetic acid |
| CAS name: | 4-chloro-2-oxo-3(2H)-benzothiazoleacetic acid |
| CAS Reg. No.: | 3813-05-6 |
| Formula: | C9H6ClNO3S |
| Activity: | herbicides (unclassified) |
| Notes: | Derivatives include benazolin-dimethylammonium [38561-76-1], benazolin-ethyl [25059-80-7], benazolin-potassium [67338-65-2]. The name “草除灵” is approved in China for benazolin and for benazolin-ethyl. The US Food and Drug Administration uses the name “benazoline” for the unrelated drug that has the INN “metizoline”. |
| Structure: |  |
| Pronunciation: | běn-āz-ō-lǐn Guide to British pronunciation |
| InChIKey: | HYJSGOXICXYZGS-UHFFFAOYSA-N |
| InChI: | InChI=1S/C9H6ClNO3S/c10-5-2-1-3-6-8(5)11(4-7(12)13)9(14)15-6/h1-3H,4H2,(H,12,13) |