| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | (4-chloro-2-oxo-1,3-benzothiazol-3(2H)-yl)acetic acid—N-methylmethanamine (1/1) |
| IUPAC name: | (4-chloro-2,3-dihydro-2-oxo-1,3-benzothiazol-3-yl)acetic acid - dimethylamine (1:1) or dimethylammonium (4-chloro-2,3-dihydro-2-oxo-1,3-benzothiazol-3-yl)acetate |
| CAS name: | 4-chloro-2-oxo-3(2H)-benzothiazoleacetic acid compound with N-methylmethanamine (1:1) |
| CAS Reg. No.: | 38561-76-1 |
| Formula: | C11H13ClN2O3S |
| Activity: | herbicides (unclassified) |
| Notes: | This substance is a derivative of benazolin [3813-05-6]. |
| Structure: | |
| Pronunciation: | běn-āz-ō-lǐn dī-mē-thīl-a-mōn-ē-am Guide to British pronunciation |
| InChIKey: | KKTYYONKWVCNJI-UHFFFAOYSA-N |
| InChI: | InChI=1S/C9H6ClNO3S.C2H7N/c10-5-2-1-3-6-8(5)11(4-7(12)13)9(14)15-6;1-3-2/h1-3H,4H2,(H,12,13);3H,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names