Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | [(2S)-1-{[(1R)-1-(6-fluoro-1,3-benzothiazol-2-yl)ethyl]amino}-3-methyl-1-oxobutan-2-yl]carbamic acid |
IUPAC name: | [(1S)-1-{[(1R)-1-(6-fluoro-1,3-benzothiazol-2-yl)ethyl]carbamoyl}-2-methylpropyl]carbamic acid |
CAS name: | N-[(1S)-1-[[[(1R)-1-(6-fluoro-2-benzothiazolyl)ethyl]amino]carbonyl]-2-methylpropyl]carbamic acid |
CAS Reg. No.: | 413615-35-7 |
Formula: | C15H18FN3O3S |
Activity: | fungicides (valinamidecarbamate) |
Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example benthiavalicarb-isopropyl [177406-68-7]. |
Structure: | |
Pronunciation: | běn-thī-a-vǎl-ǐ-karb Guide to British pronunciation |
InChIKey: | VVSLYIKSEBPRSN-PELKAZGASA-N |
InChI: | InChI=1S/C15H18FN3O3S/c1-7(2)12(19-15(21)22)13(20)17-8(3)14-18-10-5-4-9(16)6-11(10)23-14/h4-8,12,19H,1-3H3,(H,17,20)(H,21,22)/t8-,12+/m1/s1 |
A data sheet from the Compendium of Pesticide Common Names