| Approval: | ISO common name not required |
|---|---|
| IUPAC PIN: | |
| IUPAC name: | 9,10-dimethoxy-5,6-dihydro[1,3]dioxolo[4,5-g]isoquino[3,2-a]isoquinolin-7-ium |
| CAS name: | 5,6-dihydro-9,10-dimethoxy-1,3-benzodioxolo[5,6-a]benzo[g]quinolizinium |
| CAS Reg. No.: | 2086-83-1 |
| Formula: | C20H18NO4 |
| Activity: | fungicides (alkaloid) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. Derivatives include berberine chloride [633-65-8]. |
| Structure: | |
| Pronunciation: | ber-ber-ēn Guide to British pronunciation |
| InChIKey: | YBHILYKTIRIUTE-UHFFFAOYSA-N |
| InChI: | InChI=1S/C20H18NO4/c1-22-17-4-3-12-7-16-14-9-19-18(24-11-25-19)8-13(14)5-6-21(16)10-15(12)20(17)23-2/h3-4,7-10H,5-6,11H2,1-2H3/q+1 |
A data sheet from the Compendium of Pesticide Common Names