| Approval: | ISO |
|---|---|
| IUPAC PIN: | 2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]benzoic acid |
| IUPAC name: | 2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]benzoic acid |
| CAS name: | 2,6-bis[(4,6-dimethoxy-2-pyrimidinyl)oxy]benzoic acid |
| CAS Reg. No.: | 125401-75-4 |
| Formula: | C19H18N4O8 |
| Activity: | herbicides (pyrimidinyl benzoate) |
| Notes: | Derivatives include bispyribac-sodium [125401-92-5]. Two oxime derivatives of this substance has their own ISO common names, pyribenzoxim [168088-61-7] and pyriflubenzoxim [2760545-39-7]. |
| Structure: | |
| Pronunciation: | bǐs-pǐr-ǐ-bǎk Guide to British pronunciation |
| InChIKey: | RYVIXQCRCQLFCM-UHFFFAOYSA-N |
| InChI: | InChI=1S/C19H18N4O8/c1-26-12-8-13(27-2)21-18(20-12)30-10-6-5-7-11(16(10)17(24)25)31-19-22-14(28-3)9-15(23-19)29-4/h5-9H,1-4H3,(H,24,25) |
A data sheet from the Compendium of Pesticide Common Names